A7015258
7-Amino-4-trifluoromethylcoumarin , 10mMinDMSO , 53518-15-3
Synonym(s):
Coumarin 151
CAS NO.:53518-15-3
Empirical Formula: C10H6F3NO2
Molecular Weight: 229.16
MDL number: MFCD00006858
EINECS: 258-599-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-222 °C(lit.) |
| Boiling point: | 314.6±42.0 °C(Predicted) |
| Density | 1.4096 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Powder |
| pka | 1.12±0.20(Predicted) |
| color | Yellow |
| Water Solubility | Soluble in dimethyl sulfoxide (25 mg/ml), dimethyl formamide (25 mg/ml), and methanol (25 mg/ml). Insoluble in water. |
| λmax | ≤207 nm |
| BRN | 4456797 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C10H6F3NO2/c11-10(12,13)7-4-9(15)16-8-3-5(14)1-2-6(7)8/h1-4H,14H2 |
| InChIKey | JBNOVHJXQSHGRL-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(OC(=O)C=C2C(F)(F)F)c1 |
| CAS DataBase Reference | 53518-15-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 7-amino-4-(trifluoromethyl)- (53518-15-3) |
Description and Uses
Coumarin 490 is a laser dye.
Coumarin 151 is used to prepare peptidase substrates and for the synthesis of substrates for the fluorometric assay of proteolytic enzymes in biological fluids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





