PRODUCT Properties
| Melting point: | 146.0 to 150.0 °C |
| Boiling point: | 383.6±22.0 °C(Predicted) |
| Density | 1.302±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 43 mg/mL (200.73 mM);; |
| form | powder to crystal |
| pka | 7.65±0.15(Predicted) |
| color | Light yellow to Amber to Dark green |
| InChI | 1S/C13H10O3/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8,14-15H |
| InChIKey | HUYKZYIAFUBPAQ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(=O)c2ccccc2O |
| CAS DataBase Reference | 606-12-2(CAS DataBase Reference) |
Description and Uses
2,4''-Dihydroxybenzophenone is used in preparation method of anti-fog and antibacterial coating of nanocomposite material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HS Code | 2914.50.3000 |
| Storage Class | 11 - Combustible Solids |
