LN4618247
FRANGULINB , HPLC≥95% , 14101-04-3
Synonym(s):
3-(D -Apio-β-D -furanosyloxy)-1,8-dihydroxy-6-methyl-9,10-anthracenedione
CAS NO.：14101-04-3
Empirical Formula: C20H18O9
Molecular Weight: 402.35
MDL number: MFCD00016362
EINECS: 237-953-9
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196℃ |
| Boiling point: | 774.6±60.0 °C(Predicted) |
| Density | 1.655±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| pka | 6.01±0.20(Predicted) |
| form | powder |
| InChI | 1S/C20H18O9/c1-8-2-10-14(12(22)3-8)17(25)15-11(16(10)24)4-9(5-13(15)23)29-19-18(26)20(27,6-21)7-28-19/h2-5,18-19,21-23,26-27H,6-7H2,1H3/t18-,19-,20+/m0/s1 |
| InChIKey | AEQMIFRODRFTJF-SLFFLAALSA-N |
| SMILES | OC[C@]1(O)[C@@H](O)[C@@H](OC1)OC2=CC(O)=C3C(C(C(C=C(C)C=C4O)=C4C3=O)=O)=C2 |
| LogP | 3.660 (est) |
Description and Uses
Frangulin B is an anthraquinone derivative that has been investigated for having anti-inflammatory effects, and as a natural product from Formosan plants acting as an Inhibitor of DNA Methyltransferase.
