A7024058
CucurbitacinB , 10mMinDMSO , 6199-67-3
Synonym(s):
(2β,9β,10α,16α,23E)-25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-19-Norlanosta-5,23-diene-3,11,22-trione
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-186° |
| alpha | D25 +88° (c = 1.55 in ethanol) |
| Boiling point: | 546.74°C (rough estimate) |
| Density | 1.0953 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO: soluble10mg/mL, clear |
| form | powder |
| pka | 12.60±0.29(Predicted) |
| color | white to beige |
| λmax | 290nm(EtOH)(lit.) |
| Merck | 14,2614 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | IXQKXEUSCPEQRD-ALLWXVAWSA-N |
| SMILES | CC1(C)C([C@@H](O)C[C@]2([H])C1=CC[C@]([C@@](C[C@@H](O)[C@]3([H])[C@@](C)(O)C(/C=C/C(C)(C)OC(C)=O)=O)(C)[C@]3(C)C4)([H])[C@@]2(C)C4=O)=O |
Description and Uses
Cucurbitacin B is a tetracyclic triterpenoid that has been shown to have a strong antitumor activity.
Cucurbitacin B hydrate has been used:
- as a signal transducer and activator of transcription 3 (stat3) inhibitor to determine its effect on the expression of human lysosomal acid lipase (hLAL) in myeloid-derived suppressor cells (MDSCs).
- as an ecdysone receptor (EcR) antagonist injection to lower the levels of 20-hydoxyecdysone (20E) signaling in butterflies.
- to determine its effect on the cell viability of pancreatic cancer cell lines.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45-24/25 |
| RIDADR | UN 2811 6.1 / PGI |
| WGK Germany | 3 |
| RTECS | RC6190000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29153900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
| Hazardous Substances Data | 6199-67-3(Hazardous Substances Data) |
| Toxicity | LD10 orally in mice: 5 mg/kg (LeMen) |






