M0445250
CucurbitacinD , Analysis of control products, 98% , 3877-86-9
Synonym(s):
(2S,8S,9R,10R,13R,14S,16R,17R)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,16-dihydroxy-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione;Elatericin A
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151.5°C |
| Boiling point: | 521.47°C (rough estimate) |
| Density | 1.0814 (rough estimate) |
| refractive index | 1.5820 (estimate) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in ethanol and methan |
| form | powder |
| pka | 12.66±0.29(Predicted) |
| color | White |
| InChIKey | SRPHMISUTWFFKJ-VZBBWSTBNA-N |
| SMILES | [C@@]12(C)C[C@@H](O)[C@]([H])([C@](O)(C)C(=O)/C=C/C(O)(C)C)[C@@]1(C)CC(=O)[C@@]1(C)[C@]3([H])C[C@@H](C(=O)C(C)(C)C3=CCC21)O |&1:0,3,5,7,18,23,25,28,r| |
| LogP | 1.480 (est) |
| CAS DataBase Reference | 3877-86-9 |
Description and Uses
Cucurbitacin D acts as a potential potent anti-cancer agent in various cervical cancers through induction of apopotosis.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P301+P310+P330 |
| Hazard Codes | Xi |
| HS Code | 29144000 |
| Toxicity | LD50 oral in rat: 8200ug/kg |
