PRODUCT Properties
| Melting point: | 124-126 °C (lit.) |
| alpha | 47 º(c=2, chloroform) |
| Boiling point: | 321.4±10.0 °C(Predicted) |
| Density | 1.009±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| FEMA | 3794 | SCLAREOLIDE |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| color | White to Off-White |
| Odor | at 10.00 % in isopropyl myristate. dry paper woody ambergris labdanum |
| Odor Type | woody |
| optical activity | [α]20/D +47°, c = 2% in chloroform |
| biological source | Salvia sclarea L |
| Water Solubility | 10mg/L at 25℃ |
| JECFA Number | 1165 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | FRAGRANCE SKIN CONDITIONING PERFUMING |
| InChI | 1S/C16H26O2/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-13(17)18-16/h11-12H,5-10H2,1-4H3/t11-,12+,15-,16+/m0/s1 |
| InChIKey | IMKJGXCIJJXALX-SHUKQUCYSA-N |
| SMILES | [H][C@@]12CC[C@@]3(C)OC(=O)C[C@]3([H])[C@@]1(C)CCCC2(C)C |
| LogP | 4.5 at 25℃ |
| NIST Chemistry Reference | Naphtho[2,1-b]furan-2(1h)-one, decahydro-3a,6,6,9a-tetramethyl-, [3ar-(3a«alpha»,5a«beta»,9a«alpha»,9b«beta»)]-(564-20-5) |
| EPA Substance Registry System | Naphtho[2,1-b]furan-2(1H)-one, decahydro-3a,6,6,9a-tetramethyl-, (3aR,5aS,9aS,9bR)- (564-20-5) |
Description and Uses
antimicrobial
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |






