A7400512
Sclareol , ≥98% , 515-03-7
Synonym(s):
(1R,2R,8aS)-Decahydro-1-(3-hydroxy-3-methyl-4-pentenyl)-2,5,5,8a-tetramethyl-2-naphthol;Labd-14-ene-8,13-diol
CAS NO.:515-03-7
Empirical Formula: C20H36O2
Molecular Weight: 308.51
MDL number: MFCD00869558
EINECS: 208-194-0
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB143.20 | In Stock |
|
| 100MG | RMB487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-100 °C (lit.) |
| Boiling point: | 218-220 °C/19 mmHg (lit.) |
| alpha | -13 º (c=4, in carbon tetrachloride) |
| Density | 0.954±0.06 g/cm3(Predicted) |
| FEMA | 4502 | (-)-SCLAREOL |
| storage temp. | 2-8°C |
| solubility | Chlorform, Ethyl Acetate (Slightly) |
| pka | 14.49±0.29(Predicted) |
| form | Solid |
| color | White to Off-White |
| Odor | at 100.00 %. sweet balsam clary amber woody weedy |
| Odor Type | balsamic |
| biological source | Salvia sclarea L |
| optical activity | [α]25/D 13°, c = 4 in carbon tetrachloride |
| JECFA Number | 2029 |
| BRN | 2054148 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C20H36O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,15-16,21-22H,1,8-14H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | XVULBTBTFGYVRC-HHUCQEJWSA-N |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@@](C)(O)[C@@H]2CC[C@@](C)(O)C=C |
| LogP | 5.54 |
| CAS DataBase Reference | 515-03-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Naphthalenepropanol, «alpha»-ethenyldecahydro-2-hydroxy-«alpha»,2,5,5,8a-pentamethyl-, [1r-[1«alpha»(r*),2«beta»,4a«beta»,8a«alpha»]]-(515-03-7) |
| EPA Substance Registry System | Sclareol (515-03-7) |
Description and Uses
antineoplastic, apoptosis inducer
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P337+P313-P305+P351+P338 |
| WGK Germany | 2 |
| RTECS | QK0301900 |
| TSCA | TSCA listed |
| HS Code | 29061990 |
| Storage Class | 11 - Combustible Solids |




