A3106812
Diosgenine , 95% , 512-04-9
Synonym(s):
(25R)-5-Spirosten-3β-ol;3β-Hydroxy-5-spirostene;3β-hydroxy-5-spirostene; nitogenin;Nitogenin
CAS NO.:512-04-9
Empirical Formula: C27H42O3
Molecular Weight: 414.63
MDL number: MFCD00016887
EINECS: 208-134-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25g | RMB157.60 | In Stock |
|
| 100g | RMB533.60 | In Stock |
|
| 500g | RMB1713.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-208°C |
| alpha | D25 -129° (c = 1.4 in CHCl3) |
| Boiling point: | 473.46°C (rough estimate) |
| Density | 1.0483 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: 20 mg/mL, clear, slightly yellow |
| form | Solid |
| pka | 15.02±0.70(Predicted) |
| color | White to Pale Yellow |
| optical activity | -12925 (c 1.4, CHCl3) |
| Water Solubility | Soluble in chloroform (50 mg/ml), ethanol (83 mg/ml at 25°C), water (<1 mg/ml at 25°C), DMSO (<1 mg/ml at 25°C), and methanol. |
| Merck | 14,3295 |
| BRN | 94582 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | WQLVFSAGQJTQCK-VKROHFNGSA-N |
| SMILES | [H][C@]12C[C@@]3([H])[C@]4([H])CC=C5C[C@@H](O)CC[C@]5(C)[C@@]4([H])CC[C@]3(C)[C@@]1([H])[C@H](C)[C@@]6(CC[C@@H](C)CO6)O2 |
| LogP | 6.602 (est) |
| CAS DataBase Reference | 512-04-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Diosgenin(512-04-9) |
Description and Uses
Aglicone of saponin dioscin. Diosgenin exists in some food supplements and herbal medicines and lowers plasma cholesterol by increasing fecal cholesterol excretion. e and Progesterone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-24/25 |
| WGK Germany | 2 |
| RTECS | WH1450000 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |




