A7060058
Di(N-succinimidyl)3,3'-Dithiodipropionate[Cross-linkingReagent] , 10mMinDMSO , 57757-57-0
Synonym(s):
Di(N-succinimidyl) 3,3′-dithiodipropionate;Dithiobis(succinimidyl propionate);DTSP;Lomant’s reagent
CAS NO.:57757-57-0
Empirical Formula: C14H16N2O8S2
Molecular Weight: 404.42
MDL number: MFCD00042045
EINECS: 260-931-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-133 °C |
| Boiling point: | 560.1±60.0 °C(Predicted) |
| Density | 1.57±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | chloroform: 50 mg/mL |
| form | powder |
| color | Off-White |
| Appearance | White solid |
| BRN | 1518074 |
| InChI | InChI=1S/C14H16N2O8S2/c17-9-1-2-10(18)15(9)23-13(21)5-7-25-26-8-6-14(22)24-16-11(19)3-4-12(16)20/h1-8H2 |
| InChIKey | FXYPGCIGRDZWNR-UHFFFAOYSA-N |
| SMILES | S(CCC(ON1C(=O)CCC1=O)=O)SCCC(ON1C(=O)CCC1=O)=O |
| CAS DataBase Reference | 57757-57-0(CAS DataBase Reference) |
Description and Uses
DSP Crosslinker is a cleavable crosslinker. It contains two terminal NHS ester moieties which can react with primary amines. The disulfide bonds can be cleaved via a reduction reaction using Dithiothreitol (DTT) reagent.
3,3′-Dithiodipropionic acid di(N-hydroxysuccinimide ester) (DSP) has been used as a protein cross-linker.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![Di(N-succinimidyl)3,3'-Dithiodipropionate[Cross-linkingReagent]](https://img.chemicalbook.com/CAS/GIF/57757-57-0.gif)




