BD3252545
Bis(2,5-dioxopyrrolidin-1-yl)O,O'-ethane-1,2-diyldisuccinate , 97% , 70539-42-3
Synonym(s):
Di(N-succinimidyl) ethylene glycol disuccinate;EGS;Ethylene glycol bis(succinimidyl succinate);Ethylene glycol disuccinate di(N-succinimidyl) ester
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB238.40 | In Stock |
|
| 250mg | RMB317.60 | In Stock |
|
| 1g | RMB931.20 | In Stock |
|
| 5g | RMB3724.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 603.4±65.0 °C(Predicted) |
| Density | 1.52±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | acetic acid: water (1:1): ≤50mg/mL |
| form | powder |
| color | White to off-white |
| BRN | 9167119 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C18H20N2O12/c21-11-1-2-12(22)19(11)31-17(27)7-5-15(25)29-9-10-30-16(26)6-8-18(28)32-20-13(23)3-4-14(20)24/h1-10H2 |
| InChIKey | QLHLYJHNOCILIT-UHFFFAOYSA-N |
| SMILES | O(N1C(CCC1=O)=O)C(=O)CCC(=O)OCCOC(=O)CCC(=O)ON1C(CCC1=O)=O |
Description and Uses
EGS Crosslinker is a cleavable crosslinker which can be cleaved using hydroxyamine. EGS Crosslinkers contain two NHS ester groups which can react with primary amines.
Ethylene glycol-bis(succinic acid N-hydroxysuccinimide ester) is commonly used as a crosslinker in chemical reactions. It is a homobifunctional crosslinking reagent that is reactive with bromoacetate amines and sulfhydryls.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |





![Di(<i>N</i>-succinimidyl) 3,3'-Dithiodipropionate [Cross-linking Reagent]](https://img.chemicalbook.com/CAS/GIF/57757-57-0.gif)