A7093612
3-Quinolinecarbonitrile , 98% , 34846-64-5
CAS NO.:34846-64-5
Empirical Formula: C10H6N2
Molecular Weight: 154.17
MDL number: MFCD00006766
EINECS: 252-248-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB175.20 | In Stock |
|
| 1g | RMB399.20 | In Stock |
|
| 5G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110 °C (lit.) |
| Boiling point: | 323.7±15.0 °C(Predicted) |
| Density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| pka | 1.72±0.11(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C10H6N2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H |
| InChIKey | QZZYYBQGTSGDPP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=C(C#N)C=1 |
| CAS DataBase Reference | 34846-64-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Quinolinecarbonitrile(34846-64-5) |
Description and Uses
3-Quinolinecarbonitrile was used as a template for EGFR inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







