A7111812
(2R)-(−)-Glycidyl tosylate , 97% , 113826-06-5
Synonym(s):
(R)-(−)-Glycidyl p-toluenesulfonate;(R)-(−)-Glycidyl tosylate;(R)-(−)-Oxirane-2-methanol p-toluenesulfonate salt
CAS NO.:113826-06-5
Empirical Formula: C10H12O4S
Molecular Weight: 228.26
MDL number: MFCD00010834
EINECS: 601-283-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB206.40 | In Stock |
|
| 100g | RMB682.40 | In Stock |
|
| 500g | RMB2900.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49 °C(lit.) |
| Boiling point: | 340.07°C (rough estimate) |
| alpha | -18 º (c=2.5,CHCl3) |
| Density | 1.3749 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | dioxane: 50 mg/mL, clear |
| form | powder |
| color | yellow to orange |
| optical activity | -19.9° (C=1 g/100ml CHCL3) |
| Water Solubility | decomposes |
| BRN | 3592142 |
| InChI | InChI=1/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9/h2-5,9H,6-7H2,1H3/t9-/s3 |
| InChIKey | NOQXXYIGRPAZJC-DJEYLCQNNA-N |
| SMILES | C1(=CC=C(C)C=C1)S(=O)(=O)OC[C@@H]1OC1 |&1:12,r| |
| CAS DataBase Reference | 113826-06-5(CAS DataBase Reference) |
Description and Uses
(2R)-(-)-Glycidyl tosylate may be used to prepare:
- 1-O-hexadecyl-sn-glycerol 3-O-p-toluenesulfonate by reacting with 1-hexadecanol in the presence of boron trifluoride etherate.
- 4-Oxiranylmethoxy-(1H)-indole by reacting with 4-hydroxyindole in the presence of sodium hydride.
- [18F]Epifluorohydin, an intermediate for preparing of [18F]fluoromisonidazole.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H318-H341-H350-H411 |
| Precautionary statements | P201-P273-P280-P302+P352-P305+P351+P338+P310-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N,T |
| Risk Statements | 45-41-43-51/53-68 |
| Safety Statements | 61-45-36/37/39-26-53 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | RR0510000 |
| F | 3-10-21 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| HS Code | 29109000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Carc. 1B Eye Dam. 1 Muta. 2 Skin Sens. 1 |










