A7262612
(2S)-(+)-Glycidyl tosylate , 98% , 70987-78-9
Synonym(s):
(S)-(+)-Glycidyl p-toluenesulfonate;(S)-(+)-Oxirane-2-methanol p-toluenesulfonate
CAS NO.：70987-78-9
Empirical Formula: C10H12O4S
Molecular Weight: 228.26
MDL number: MFCD00064489
EINECS: 417-210-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB302.40 | In Stock |
|
| 100g | RMB1107.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49 °C(lit.) |
| alpha | 17 º (c=2.5, CHCl3) |
| Boiling point: | 340.07°C (rough estimate) |
| Density | 1.3749 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Dioxane (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Fluffy Powder |
| color | White |
| optical activity | Consistent with structure |
| Water Solubility | decomposes |
| BRN | 3592143 |
| InChI | InChI=1/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9/h2-5,9H,6-7H2,1H3/t9-/s3 |
| InChIKey | NOQXXYIGRPAZJC-DJEYLCQNNA-N |
| SMILES | C1(=CC=C(C)C=C1)S(=O)(=O)OC[C@H]1OC1 |&1:12,r| |
| CAS DataBase Reference | 70987-78-9(CAS DataBase Reference) |
| NIST Chemistry Reference | (2S)-glycidyl tosylate(70987-78-9) |
Description and Uses
Used in the first enantioselective synthesis of (R)- and (S)-4-acetyl-3-(hydroxymethyl)-3,4-dihydro-2H-pyrido[3,2-b]oxazines.
Safety
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H318-H341-H350-H411 |
| Precautionary statements | P201-P273-P280-P302+P352-P305+P351+P338+P310-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,N,Xi |
| Risk Statements | 45-41-43-51/53-68 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | RR0510050 |
| F | 3-10-21 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29109000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Carc. 1B Eye Dam. 1 Muta. 2 Skin Sens. 1 |
