A7120012
Rhein , Analysis of standard products, ≥98% , 478-43-3
Synonym(s):
Rheic acid;Rhubarb yellow;4,5-Dihydroxyanthraquinone-2-carboxylic acid;9,10-Dihydro-4,5-dihydroxy-9,10-dioxo-2-anthracenecarboxylic acid;Cassic acid
CAS NO.:478-43-3
Empirical Formula: C15H8O6
Molecular Weight: 284.22
MDL number: MFCD00009618
EINECS: 207-521-4
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB123.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C (lit.) |
| Boiling point: | 346.72°C (rough estimate) |
| Density | 1.3269 (rough estimate) |
| refractive index | 1.4413 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.17±0.20(Predicted) |
| color | Yellow to Dark Orange |
| Water Solubility | <0.1 g/100 mL at 17 ºC |
| λmax | 432nm(MeOH)(lit.) |
| Merck | 14,8176 |
| BRN | 2222155 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | 1S/C15H8O6/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17/h1-5,16-17H,(H,20,21) |
| InChIKey | FCDLCPWAQCPTKC-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(O)c2C(=O)c3c(O)cccc3C(=O)c2c1 |
| LogP | 4.290 (est) |
| CAS DataBase Reference | 478-43-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Anthracenecarboxylic acid, 9,10-dihydro-4,5-dihydroxy-9,10-dioxo- (478-43-3) |
Description and Uses
Rhein was used to induce necrosis-apoptosis switch in injured pancreatic acinar cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 2 |
| RTECS | CA9516000 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





