A7132412
Ranitidine hydrochloride , ≥98%(HPLC) , 66357-59-3
Synonym(s):
N, N Dimethyl-5-[2-(1-methylamine-2-nitrovinyl)-ethylthiomethyl]furfurylamine hydrochloride;Ranitidine hydrochloride
CAS NO.：66357-59-3
Empirical Formula: C13H23ClN4O3S
Molecular Weight: 350.86
MDL number: MFCD00069339
EINECS: 266-333-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB300.80 | In Stock |
|
| 100g | RMB1048.00 | In Stock |
|
| 500g | RMB2999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134°C (dec.) |
| storage temp. | 2-8°C |
| solubility | H2O: 1.8 mg/mL |
| form | solid |
| color | tan |
| Water Solubility | Soluble in water, 2-hydroxypropyl-beta-cyclodextrin, acetic acid, methanol, ethanol and dimethyl sulfoxide. Insoluble in chloroform. |
| Sensitive | Hygroscopic |
| Merck | 14,8110 |
| BCS Class | 3/1 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C13H22N4O3S.ClH/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3;/h4-5,9,14-15H,6-8,10H2,1-3H3;1H/b13-9+; |
| InChIKey | GGWBHVILAJZWKJ-KJEVSKRMSA-N |
| SMILES | C(/NC)(\NCCSCC1OC(CN(C)C)=CC=1)=C/[N+]([O-])=O.[H]Cl |
| CAS DataBase Reference | 66357-59-3(CAS DataBase Reference) |
Description and Uses
An H-2 histamine receptor antagonistRanitidine hydrochloride is mainly used as an H2-receptor antagonist and helps in the treatment of gastrointestinal lesions because of excessive gastric acid secretion. It also serves as an antiulcer drug.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | F,T |
| Risk Statements | 20/21/22-39/23/24/25-23/24/25-11 |
| Safety Statements | 22-24/25-45-36/37-16-7 |
| WGK Germany | 2 |
| RTECS | KM6557000 |
| HS Code | 2932190002 |
