A7133812
RGFP966 , ≥98% , 1396841-57-8
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB254.40 | In Stock |
|
| 25MG | RMB756.80 | In Stock |
|
| 100MG | RMB3039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 630.4±55.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: 20mg/mL, clear |
| pka | 11.58±0.70(Predicted) |
| form | powder |
| color | white to beige |
| InChI | 1S/C21H19FN4O/c22-18-9-10-20(19(23)13-18)25-21(27)11-8-17-14-24-26(15-17)12-4-7-16-5-2-1-3-6-16/h1-11,13-15H,12,23H2,(H,25,27)/b7-4+,11-8+ |
| InChIKey | BLVQHYHDYFTPDV-VCABWLAWSA-N |
| SMILES | NC1=CC(F)=CC=C1NC(/C=C/C(C=N2)=CN2C/C=C/C3=CC=CC=C3)=O |
Description and Uses
RGFP966 is a histone deacetylase 3 (HDAC3) inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P280 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
