A7150212
(<i>R</i>)-(+)-3-Butyn-2-ol , >98.0%(GC) , 42969-65-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB239.20 | In Stock |
|
| 1G | RMB467.20 | In Stock |
|
| 5G | RMB1408.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22.07°C (estimate) |
| alpha | 46.7 º (neat) |
| Boiling point: | 108-111 °C (lit.) |
| Density | 0.89 g/mL at 25 °C (lit.) |
| refractive index | 1.4235-1.4255 |
| Flash point: | 10°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 13.28±0.20(Predicted) |
| Specific Gravity | 0.88 |
| color | Clear colorless to yellow |
| optical activity | [α]22/D +45°, neat |
| BRN | 3587272 |
| InChI | InChI=1S/C4H6O/c1-3-4(2)5/h1,4-5H,2H3/t4-/m1/s1 |
| InChIKey | GKPOMITUDGXOSB-SCSAIBSYSA-N |
| SMILES | C[C@@H](O)C#C |
| CAS DataBase Reference | 42969-65-3(CAS DataBase Reference) |
Description and Uses
(R)-(+)-3-Butyn-2-ol may be used as a starting material in the multi-step synthesis of (R)-benzyl 4-hydroxyl-2-pentynoate.
Safety
| Symbol(GHS) |     GHS02,GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H300+H330-H315-H317-H318-H335-H351 |
| Precautionary statements | P202-P210-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | F,T+ |
| Risk Statements | 11-23/24/25-36/37/38-28-24-43-41-40-26/28-10 |
| Safety Statements | 16-23-26-36/37/39-45-28A-24 |
| RIDADR | 1986 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29052900 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
