A7247918
<SC>L</SC>-Dihydroorotic acid , ≥98% , 5988-19-2
Synonym(s):
L -Hydroorotic acid;2,6-Dioxohexahydro-4-pyrimidinecarboxylic acid;Dihydro-L -orotic acid
CAS NO.:5988-19-2
Empirical Formula: C5H6N2O4
Molecular Weight: 158.11
MDL number: MFCD00085339
EINECS: 624-952-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB205.60 | In Stock |
|
| 5g | RMB268.80 | In Stock |
|
| 25g | RMB720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-255 °C (dec.)(lit.) |
| Boiling point: | 283.16°C (rough estimate) |
| Density | 1.523 |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Water (Slightly, Heated, Sonicated) |
| pka | 2.82±0.20(Predicted) |
| form | Powder |
| color | White to off-white |
| Water Solubility | Soluble in water (partly), and dimethyl formamide. |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/t2-/m0/s1 |
| InChIKey | UFIVEPVSAGBUSI-REOHCLBHSA-N |
| SMILES | C1(=O)NC(=O)C[C@@H](C(O)=O)N1 |
| CAS DataBase Reference | 5988-19-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Orotic acid, dihydro-, l-(5988-19-2) |
Description and Uses
L-Dihydroorotic acid a metabolite.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





