A7288012
Sodium bis(trimethylsilyl)amide , 2.0MinTHF(40%) , 1070-89-9
Synonym(s):
Hexamethyldisilazane sodium salt;Hexamethyldisilazane sodium salt solution;HMN-Na Sol;NaHMDS solution
CAS NO.:1070-89-9
Empirical Formula: C6H18NNaSi2
Molecular Weight: 183.37
MDL number: MFCD00009835
EINECS: 213-983-8
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB194.40 | In Stock |
|
| 500ML | RMB523.20 | In Stock |
|
| 800ml | RMB719.20 | In Stock |
|
| 1L | RMB827.20 | In Stock |
|
| 5L | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-175 °C (lit.) |
| Boiling point: | 67°C |
| Density | 0.904 g/mL at 25 °C |
| Flash point: | 43 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in hexane, toluene, ether,terahydrofuran, benzene and toluene. |
| form | Liquid |
| Specific Gravity | 0.9 |
| color | Clear orange to brown |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3629917 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | 1S/C6H18NSi2.Na/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([Na])[Si](C)(C)C |
| CAS DataBase Reference | 1070-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | Silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, sodium salt (1070-89-9) |
Description and Uses
Sodium bis(trimethylsilyl)amide is a synthetically useful reagent in that it combines both high basicity and nucleophilicity, each of which may be exploited for useful organic transformations such as selective formation of enolates, preparation of Wittig reagents, formation of acyl anion equivalents, and the generation of carbenoid species. As a nucleophile, it has been used as a nitrogen source for the preparation of primary amines.It is useful as a sterically hindered base and as a nucleophile.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,F |
| Risk Statements | 14-34-19-11-67-65-63-48/20-14/15-40-37 |
| Safety Statements | 26-45-62-36/37/39-33-16-43-8 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






