A7292012
                    (-)-Scopolamine hydrobromide trihydrate , 98% , 6533-68-2
                            Synonym(s):
Hyoscine hydrobromide;Scopine tropate
                            
                        
                CAS NO.:6533-68-2
Empirical Formula: C17H28BrNO7
Molecular Weight: 438.31
MDL number: MFCD00150066
EINECS: 613-776-6
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB239.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB992.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB3199.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 197-194 °C | 
                                    
| refractive index | -25.5 ° (C=5, H2O) | 
                                    
| storage temp. | Poison room | 
                                    
| solubility | H2O: soluble50mg/mL | 
                                    
| form | Crystals or Crystalline Powder | 
                                    
| color | white to off-white | 
                                    
| optical activity | [α]25/D 24 to 26°, c = 5 in H2O(lit.) | 
                                    
| Water Solubility | H2O: 50mg/mL | 
                                    
| Merck | 14,8406 | 
                                    
| BRN | 6100669 | 
                                    
| Stability: | Stable, but air and light sensitive. Incompatible with acids, bases, strong oxidizing agents. Slightly hygroscopic. | 
                                    
| InChI | InChI=1/C17H21NO4.BrH.H2O/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;;/h2-6,11-16,19H,7-9H2,1H3;1H;1H2/t11-,12-,13-,14+,15-,16+;;/s3 | 
                                    
| InChIKey | UXOOBDDSNJVVBU-MJICIYPYNA-N | 
                                    
| SMILES | CN1[C@@H]2C[C@@H](OC(=O)[C@@H](C3C=CC=CC=3)CO)C[C@H]1[C@@H]1O[C@H]21.Br.O |&1:2,4,8,18,19,21,r| | 
                                    
| LogP | 0.760 (est) | 
                                    
| CAS DataBase Reference | 6533-68-2(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Scopolamine hydrobromide trihydrate (6533-68-2) | 
                                    
Description and Uses
Scopolamine hydrobromide is a bronchodilator indicated for the maintenance treatment of chronic obstructive pulmonary disease (COPD), including chronic bronchitis and emphysema, the maintenance treatment of concomitant dyspnea and the prevention of acute exacerbations.
Scopolamine is a nasal decongestant and adrenergic agonist that is used to dilate the pupil, reduce eye focusing ability, control saliva and gastric acid production, slow intestinal movements, and prevent vomiting.
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H300+H310+H330 | 
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 | 
| Hazard Codes | T+ | 
| Risk Statements | 26/27/28 | 
| Safety Statements | 45-25-1 | 
| RIDADR | UN1544 6.1/PG 3 | 
| WGK Germany | 1 | 
| RTECS | YM4550000 | 
| HazardClass | 6.1 | 
| PackingGroup | III | 
| HS Code | 29399990 | 






