A7301312
N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate , 98% , 265651-18-1
Synonym(s):
O-(N-Succinimidyl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate;HSTU
CAS NO.：265651-18-1
Empirical Formula: C9H16F6N3O3P
Molecular Weight: 359.21
MDL number: MFCD01863753
| Pack Size | Price | Stock | Quantity |
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB341.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-221°C |
| storage temp. | -20°C |
| solubility | Soluble in acetonitrile 0.5 g/mL. |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| Sensitive | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H16N3O3.F6P/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14;1-7(2,3,4,5)6/h5-6H2,1-4H3;/q+1;-1 |
| InChIKey | STWZCCVNXFLDDD-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].O(N1C(CCC1=O)=O)/C(=[N+](\C)/C)/N(C)C |
| CAS DataBase Reference | 265651-18-1(CAS DataBase Reference) |
Description and Uses
Coupling reagent for peptide synthesis and the formation of other amides. Reactant for synthesis of liposomal contrast agents for magnetic resonance imaging, synthesis of protein labeling molecules, synthesis of thiol-reactive Cy5 derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-60-37 |
| WGK Germany | 3 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
