A7306412
Sodium nitroferricyanide dihydrate , ACS,99% , 13755-38-9
Synonym(s):
Sodium nitroprusside;Sodium nitroferricyanide;Sodium nitroprusside dihydrate;SNP;SNP, Sodium Nitroferricyanide(III) Dihydrate
CAS NO.:13755-38-9
Empirical Formula: C5H4FeN6Na2O3
Molecular Weight: 297.95
MDL number: MFCD00149192
EINECS: 604-025-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| 500G | RMB1040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.72 |
| bulk density | 1000kg/m3 |
| storage temp. | 2-8°C |
| solubility | 400g/l (slow decomposition) |
| form | Crystals |
| color | Ruby red |
| Specific Gravity | 1.72 |
| PH | 5 (50g/l, H2O, 20℃) |
| Water Solubility | Soluble in water. Slightly soluble ethanol. |
| Sensitive | Hygroscopic |
| Merck | 14,8649 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 1 mg/m3 |
| InChI | InChI=1S/5CN.Fe.NO.Na.H2O/c5*1-2;;1-2;;/h;;;;;;;;1H2/q5*-1;+2;2*+1; |
| InChIKey | OIRZWVYIQXBRFC-UHFFFAOYSA-N |
| SMILES | [Fe+2](N#[O+])([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[Na+].O |
| CAS DataBase Reference | 13755-38-9 |
Description and Uses
Reagent for the analysis of zinc, sulphide, sulphur dioxide, acetone and organic compounds.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T,T+ |
| Risk Statements | 25-26/27/28 |
| Safety Statements | 45-36/37/39-22 |
| RIDADR | UN 3288 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LJ8925000 |
| F | 3 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28372000 |
| Toxicity | LD50 orally in Rabbit: 99 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





