A7331912
(S)-(+)-1-Cbz-3-pyrrolidinol , 97% , 100858-32-0
Synonym(s):
(S)-N-Z-3-Pyrrolidinol;(S)-1-Benzyloxycarbonyl-3-pyrrolidinol;(S)-1-Carbobenzoxy-3-pyrrolidinol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25g | RMB482.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-77 °C |
| Boiling point: | 370.7±42.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 14.72±0.20(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +21°, c = 1 in chloroform |
| InChI | InChI=1S/C12H15NO3/c14-11-6-7-13(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11,14H,6-9H2/t11-/m0/s1 |
| InChIKey | MBLJFGOKYTZKMH-NSHDSACASA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CC[C@H](O)C1 |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45-25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29339900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






![Benzyl3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate](https://img.chemicalbook.com/CAS/GIF/130753-13-8.gif)