A7365712
SD-208 , ≥98% , 627536-09-8
Synonym(s):
2-(5-Chloro-2-fluorophenyl)pteridin-4-yl]pyridin-4-yl-amine
CAS NO.：627536-09-8
Empirical Formula: C17H10ClFN6
Molecular Weight: 352.75
MDL number: MFCD09038685
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB399.20 | In Stock |
|
| 25MG | RMB1439.20 | In Stock |
|
| 100MG | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 460.4±45.0 °C(Predicted) |
| Density | 1.487 |
| storage temp. | 2-8°C |
| solubility | DMSO: >5mg/mL |
| pka | 4.56±0.26(Predicted) |
| form | powder |
| color | off-white to tan |
| InChI | 1S/C17H10ClFN6/c18-10-1-2-13(19)12(9-10)15-24-16-14(21-7-8-22-16)17(25-15)23-11-3-5-20-6-4-11/h1-9H,(H,20,22,23,24,25) |
| InChIKey | BERLXWPRSBJFHO-UHFFFAOYSA-N |
| SMILES | Fc1ccc(Cl)cc1-c2nc(Nc3ccncc3)c4nccnc4n2 |
Description and Uses
SD-208 was used to inhibit the activity of ALK5 kinase in bovine retinal vascular cells.2
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
