A7393412
L-Glutamic acid 5-tert-butyl ester , ≥98.0% , 2419-56-9
CAS NO.：2419-56-9
Empirical Formula: C9H17NO4
Molecular Weight: 203.24
MDL number: MFCD00038580
EINECS: 607-337-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 10g | RMB175.20 | In Stock |
|
| 25G | RMB340.00 | In Stock |
|
| 100G | RMB1072.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182°C(lit.) |
| Boiling point: | 110 °C(Press: 0.05 Torr) |
| Density | 0.992 g/cm3 |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 2.20±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| Water Solubility | Sparingly soluble in water; practically insoluble in ethanol or ether. |
| BRN | 2049031 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)14-7(11)5-4-6(10)8(12)13/h6H,4-5,10H2,1-3H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | OIOAKXPMBIZAHL-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)N |
| CAS DataBase Reference | 2419-56-9(CAS DataBase Reference) |
Description and Uses
L-Glutamic acid 5-tert-butyl ester is used as a fine chemical intermediate, pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22-24 |
| Safety Statements | 22-24/25-25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
