A7395512
(1S,2S)-Cyclohexane-1,2-dicarboxylicacid , 98% , 21963-41-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB134.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184 °C |
| Boiling point: | 384.1±35.0 °C(Predicted) |
| Density | 1.314 |
| refractive index | 18 ° (C=1, Acetone) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in acetone(almost transparency). |
| form | powder to crystal |
| pka | 4.18±0.28(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6-/m0/s1 |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | [C@H]1(C(O)=O)CCCC[C@@H]1C(O)=O |
| CAS DataBase Reference | 21963-41-7 |
Description and Uses
A series of new C2-symmetric (1S,2S)-cyclohexane-1,2-dicarboxamides was synthesized from (1S,2S)-Cyclohexane-1,2-dicarboxylic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2917198090 |
