A7411912
<small>DL</small>-Valinol , >98.0%(GC) , 16369-05-4
Synonym(s):
DL -Valinol
CAS NO.:16369-05-4
Empirical Formula: C5H13NO
Molecular Weight: 103.16
MDL number: MFCD00004730
EINECS: 240-425-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB77.60 | In Stock |
|
| 5G | RMB220.80 | In Stock |
|
| 25g | RMB768.80 | In Stock |
|
| 100g | RMB2732.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-32℃ |
| Boiling point: | 75-77 °C8 mm Hg(lit.) |
| Density | 0.936 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| form | Liquid |
| pka | 12.82±0.10(Predicted) |
| color | Clear yellow |
| optical activity | 0.3825°(C=1g/100ml ETOH) |
| InChI | InChI=1S/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | NWYYWIJOWOLJNR-UHFFFAOYSA-N |
| SMILES | C(O)C(N)C(C)C |
| CAS DataBase Reference | 16369-05-4(CAS DataBase Reference) |
Description and Uses
2-Amino-3-methyl-1-butanol was used in the synthesis of 1-allyl-2-pyrroleimines. It was also used as chiral nucleophile in the total synthesis of benanomicin-pradimicin antibiotics. It was used as homochiral guest compound during synthesis of crown ethers containing two chiral subunits.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







