A7433012
<i>S</i>-(2-Aminoethyl)isothiouronium Bromide Hydrobromide , >98.0%(T) , 56-10-0
Synonym(s):
2-(2-Aminoethyl)-2-thiopseudourea dihydrobromide;AET;S-(2-Aminoethyl)isothiouronium bromide hydrobromide;S-(2-Aminoethyl)thiouronium bromide hydrobromide
CAS NO.:56-10-0
Empirical Formula: C3H11Br2N3S
Molecular Weight: 281.01
MDL number: MFCD00037011
EINECS: 200-257-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB335.20 | In Stock |
|
| 100g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-196 °C(lit.) |
| Density | 1.94 g/cm3 |
| storage temp. | Store below +30°C. |
| solubility | 50g/l |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | almost transparency |
| Merck | 14,178 |
| BRN | 3911163 |
| InChI | InChI=1S/C3H9N3S.2BrH/c4-1-2-7-3(5)6;;/h1-2,4H2,(H3,5,6);2*1H |
| InChIKey | XDVMCVGTDUKDHL-UHFFFAOYSA-N |
| SMILES | S(CCN)C(=N)N.Br.Br |
| CAS DataBase Reference | 56-10-0(CAS DataBase Reference) |
| EPA Substance Registry System | Carbamimidothioic acid, 2-aminoethyl ester, dihydrobromide (56-10-0) |
Description and Uses
S-
NOS inhibitor
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37-22 |
| WGK Germany | 3 |
| RTECS | UM0175000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2930 90 98 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 in mice (mg/kg): 100 i.v., 280 s.c., 480 i.p., 1600 orally (Pospisil) |







