A7472012
<SC>DL</SC>-<WBR>3,5-<WBR>Difluorophenylalanine , 97% , 32133-37-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB111.20 | In Stock |
|
| 500MG | RMB143.20 | In Stock |
|
| 1g | RMB271.20 | In Stock |
|
| 5g | RMB831.68 | In Stock |
|
| 25g | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269.5-273.5 °C(lit.) |
| Boiling point: | 295.1±40.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.13±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C9H9F2NO2/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14) |
| InChIKey | QFGMPXZFCIHYIR-UHFFFAOYSA-N |
| SMILES | NC(Cc1cc(F)cc(F)c1)C(O)=O |
| CAS DataBase Reference | 32133-37-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |






