A7531312
(S)-3-Amino-3-phenylpropanoic acid , 98% , 40856-44-8
CAS NO.：40856-44-8
Empirical Formula: C9H11NO2
Molecular Weight: 165.19
MDL number: MFCD01076238
EINECS: 609-874-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB139.20 | In Stock |
|
| 100g | RMB486.40 | In Stock |
|
| 500g | RMB1723.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251-253 °C(Solv: water (7732-18-5); acetone (67-64-1)) |
| Boiling point: | 307.5±30.0 °C(Predicted) |
| Density | 1.198±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Sparingly) |
| form | Solid |
| pka | 3.45±0.12(Predicted) |
| color | White to Off-White |
| optical activity | -6.0°(C=0.0103.11 g/100ml H2O) |
| InChI | InChI=1/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/s3 |
| InChIKey | UJOYFRCOTPUKAK-SBYBRXNCNA-N |
| SMILES | [C@H](C1C=CC=CC=1)(N)CC(=O)O |&1:0,r| |
| CAS DataBase Reference | 40856-44-8(CAS DataBase Reference) |
Description and Uses
S)-β-Phenylalanine is a key building block used as an intermediate in the synthesis of pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2922498590 |
