A7581958
NBQX , 10mMinDMSO , 118876-58-7
Synonym(s):
1,2,3,4-Tetrahydro-6-nitro-2,3-dioxo-benzo[f]quinoxaline-7-sulfonamide disodium salt hydrate;1,2,3,4-Tetrahydro-6-nitro-2,3-dioxo-benzo[f]quinoxaline-7-sulfonamide hydrate;FG 9202;FG 9202 disodium salt hydrate
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 361°C |
| Density | 1.6027 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | methanol: 0.25 mg/mL |
| form | solid |
| pka | 7.55±0.20(Predicted) |
| color | yellow |
| Water Solubility | H2O: >10mg/mL |
| Stability: | Freezer at -20°C |
| InChI | InChI=1S/C12H8N4O6S/c13-23(21,22)8-3-1-2-5-9(8)7(16(19)20)4-6-10(5)15-12(18)11(17)14-6/h1-4H,(H,14,17)(H,15,18)(H2,13,21,22) |
| InChIKey | UQNAFPHGVPVTAL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C3=CC=CC(S(N)(=O)=O)=C3C([N+]([O-])=O)=C2)NC(=O)C1=O |
Description and Uses
A potent and discriminating antagonist for AMPA binding sites. This compound has neuroprotective properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







