A7634012
3,4,5-Trimethoxycinnamic acid , 99% , 90-50-6
CAS NO.：90-50-6
Empirical Formula: C12H14O5
Molecular Weight: 238.24
MDL number: MFCD00004388
EINECS: 201-999-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB70.40 | In Stock |
|
| 100G | RMB198.40 | In Stock |
|
| 500g | RMB767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-127 °C (lit.) |
| Boiling point: | 300.83°C (rough estimate) |
| Density | 1.1416 (rough estimate) |
| vapor pressure | 0-0Pa at 20-25℃ |
| refractive index | 1.4571 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid:crystalline |
| pka | 4.48±0.10(Predicted) |
| color | White |
| BRN | 1537834 |
| InChI | InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14) |
| InChIKey | YTFVRYKNXDADBI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC(OC)=C(OC)C(OC)=C1 |
| LogP | 0.3-1.1 at 35℃ and pH2-7 |
| CAS DataBase Reference | 90-50-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(3,4,5-trimethoxyphenyl)- (90-50-6) |
Description and Uses
3-(3,4,5-Trimethoxyphenyl)acrylic acid demonstrates antioxidant activity as it was detected to inhibit lipid peroxidation in rat brain homogenates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | GE0722000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
