A7645912
4,4′-Thiobisbenzenethiol , 98% , 19362-77-7
Synonym(s):
Bis(4-mercaptophenyl) sulfide
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| 25G | RMB606.40 | In Stock |
|
| 100g | RMB2310.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C(lit.) |
| Boiling point: | 148 °C / 12mmHg |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.86±0.10(Predicted) |
| color | White to Pale Yellow |
| InChI | InChI=1S/C12H10S3/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,13-14H |
| InChIKey | JLLMOYPIVVKFHY-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C(S)C=C1)C1=CC=C(S)C=C1 |
| CAS DataBase Reference | 19362-77-7(CAS DataBase Reference) |
Description and Uses
4,4''-Thiobisbenzenethiol acts as a reducing agent, and affects the catalytic activity of caspase-3 protein.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2930.90.2900 |
