A7652112
3,4,5-Trimethoxyphenylacetonitrile , 97% , 13338-63-1
Synonym(s):
3,4,5-Trimethoxybenzyl cyanide
CAS NO.:13338-63-1
Empirical Formula: C11H13NO3
Molecular Weight: 207.23
MDL number: MFCD00001912
EINECS: 236-388-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB456.00 | In Stock |
|
| 100g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79 °C (lit.) |
| Boiling point: | 346.25°C (rough estimate) |
| Density | 1.1878 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| color | White to Light yellow |
| BRN | 2214548 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C11H13NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4H2,1-3H3 |
| InChIKey | ACFJNTXCEQCDBX-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 13338-63-1(CAS DataBase Reference) |
Description and Uses
3,4,5-Trimethoxyphenylacetonitrile is used in insecticide compositions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | AM2475000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






