A7668012
Titanium butoxide , CP,98.0% , 5593-70-4
Synonym(s):
Orthotitanic acid tetrabutylester;Tetrabutyl orthotitanate;Tetrabutyl titanate;TNBT;TYZOR TBT organic titanate
CAS NO.:5593-70-4
Empirical Formula: C16H36O4Ti
Molecular Weight: 340.32
MDL number: MFCD00009433
EINECS: 227-006-8
| Pack Size | Price | Stock | Quantity |
| 500ML | RMB87.20 | In Stock |
|
| 2.5L | RMB460.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -55°C |
| Boiling point: | 206 °C/10 mmHg (lit.) |
| Density | 1.00 g/mL at 20 °C (lit.) |
| vapor pressure | 5.6 hPa (20 °C) |
| refractive index | n |
| Flash point: | 55 °F |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Miscible with aliphatic, aromatic, chlorinated and oxygenated solvents. |
| form | Liquid |
| Specific Gravity | 0.998 |
| color | Pale yellow |
| explosive limit | 2.0-12.0%(V) |
| Water Solubility | RAPIDLY HYDROLIZED |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 4148236 |
| Stability: | Stable, but moisture sensitive. Flammable. Incompatible with water, moisture, strong oxidizing agents, strong acids. |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/4C4H9O.Ti/c4*1-2-3-4-5;/h4*2-4H2,1H3;/q4*-1;+4 |
| InChIKey | YHWCPXVTRSHPNY-UHFFFAOYSA-N |
| SMILES | CCCCO[Ti](OCCCC)(OCCCC)OCCCC |
| LogP | 0.84 at 25℃ |
| CAS DataBase Reference | 5593-70-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutoxytitanium(5593-70-4) |
| EPA Substance Registry System | Tetrabutyl titanate (5593-70-4) |
Description and Uses
Titanium(IV) butoxide is a sourcing material for the preparation of titanium oxide (TiO2) which can further be used in a variety of applications such as dye sensitized solar cells (DSSCs), photo-catalytic and self-cleaning based coatings.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H315-H318-H335-H336 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Central nervous system, Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 10-36/37/38-67-41-37/38-45 |
| Safety Statements | 16-26-39-24/25-53 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 1 |
| RTECS | XR1585000 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29051900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 5593-70-4(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 3122 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








