A7682012
Titanium isopropoxide , 95% , 546-68-9
Synonym(s):
Tetraisopropyl orthotitanate;TTIP
CAS NO.:546-68-9
Empirical Formula: C12H28O4Ti
Molecular Weight: 284.22
MDL number: MFCD00008871
EINECS: 208-909-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 14-17 °C(lit.) |
| Boiling point: | 232 °C(lit.) |
| Density | 0.96 g/mL at 20 °C(lit.) |
| vapor pressure | 60.2hPa at 25℃ |
| refractive index | n |
| Flash point: | 72 °F |
| storage temp. | Flammables area |
| solubility | Soluble in anhydrous ethanol, ether, benzene and chloroform. |
| form | Liquid |
| Specific Gravity | 0.955 |
| color | Colorless to pale yellow |
| Water Solubility | HYDROLYSIS |
| FreezingPoint | 14.8℃ |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Merck | 14,9480 |
| BRN | 3679474 |
| Stability: | Stable, but decomposes in the presence of moisture. Incompatible with aqueous solutions, strong acids, strong oxidizing agents. Flammable. |
| InChI | 1S/4C3H7O.Ti/c4*1-3(2)4;/h4*3H,1-2H3;/q4*-1;+4 |
| InChIKey | VXUYXOFXAQZZMF-UHFFFAOYSA-N |
| SMILES | CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C |
| LogP | 0.05 |
| CAS DataBase Reference | 546-68-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, titanium(4+) salt (546-68-9) |
Description and Uses
Titanium(IV) isopropoxide is used as a precursor for the preparation of titanium and barium-strontium-titanate thin films. It is useful to make porous titanosilicates and potential ion-exchange materials for cleanup of radioactive wastes. It is an active component of Sharpless epoxidation as well as involved in the synthesis of chiral epoxides. In Kulinkovich reaction, it is involved as a catalyst in the preparation of cyclopropanes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H319-H336 |
| Precautionary statements | P210-P233-P240-P241-P242-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36-36/37/38-11-67 |
| Safety Statements | 16-26-36/37/39-7/9 |
| RIDADR | UN 2413 3/PG 3 |
| WGK Germany | 2 |
| RTECS | NT8060000 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29051900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 STOT SE 3 |
| Hazardous Substances Data | 546-68-9(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







