A7691312
Tetrabutylammonium hexafluorophosphate , 98% , 3109-63-5
CAS NO.：3109-63-5
Empirical Formula: C16H36F6NP
Molecular Weight: 387.43
MDL number: MFCD00011748
EINECS: 221-472-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB225.60 | In Stock |
|
| 250g | RMB554.40 | In Stock |
|
| 500G | RMB948.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244-246 °C (lit.) |
| Boiling point: | 242-246 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder and/or Chunks |
| color | White to off-white |
| Sensitive | Hygroscopic |
| BRN | 4056584 |
| InChI | InChI=1S/C16H36N.F6P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-7(2,3,4,5)6/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | BKBKEFQIOUYLBC-UHFFFAOYSA-N |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[P-](F)(F)(F)(F)(F)F |
| CAS DataBase Reference | 3109-63-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutylammonium hexafluorophosphate(3109-63-5) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, hexafluorophosphate(1-) (3109-63-5) |
Description and Uses
Tetrabutylammonium hexafluorophosphate can be used as a supporting electrolyte for the formation of cyclic disulfide moiety of 3,5-diimido-1,2-dithiolane derivatives by S-S coupling of dithioanilides.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P501a-P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Hygroscopic |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29239000 |
