PRODUCT Properties
| storage temp. | Store at RT. |
| solubility | DMSO (Slightly), Water (Slightly) |
| Colour Index | 23860 |
| form | Powder/Solid |
| color | Dark Brown |
| Water Solubility | 280 g/L (20 ºC) |
| Merck | 14,3905 |
| Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | AFPPOOOTZAGPEB-DVDDBBOFSA-N |
| SMILES | NC1=C(C=C(S(O)(=O)=O)C2=CC=C(/N=N/C3C=CC(C4C=CC(/N=N/C5C=CC6=C(C=C(S(O)(=O)=O)C(N)=C6C=5O)S(O)(=O)=O)=C(C)C=4)=CC=3C)C(O)=C12)S(O)(=O)=O.[NaH] |
| CAS DataBase Reference | 314-13-6 |
| IARC | 3 (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System | C.I. Direct Blue 53 (314-13-6) |
Description and Uses
Evans Blue is used for estimation of blood volume and in double-labeling procedure for studying axonal branching. It acts as an inhibitor of L-glutamate and kainate receptor-mediated currents. It is also a P2X-selective purinoceptor antagonist. It is also useful in molecular biology.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | T,F |
| Risk Statements | 45-63-11-61-20/21/22 |
| Safety Statements | 53-45-36/37-16-36/37/39 |
| WGK Germany | 3 |
| RTECS | QJ6440000 |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B |
| Toxicity | LD50 intraperitoneal in mouse: 340mg/kg |





