A7693612
Bromanil , 98% , 488-48-2
CAS NO.:488-48-2
Empirical Formula: C6Br4O2
Molecular Weight: 423.68
MDL number: MFCD00013785
EINECS: 207-679-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB719.20 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 292-294 °C(lit.) |
| Boiling point: | 340.5±42.0 °C(Predicted) |
| Density | 3.127±0.06 g/cm3(Predicted) |
| storage temp. | Store below +30°C. |
| solubility | Acetone (Slightly), DMSO (Slightly) |
| form | Crystalline Powder |
| color | Yellow |
| BRN | 1912183 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C6Br4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
| InChIKey | LWHDQPLUIFIFFT-UHFFFAOYSA-N |
| SMILES | C1(=O)C(Br)=C(Br)C(=O)C(Br)=C1Br |
| CAS DataBase Reference | 488-48-2(CAS DataBase Reference) |
Description and Uses
A halogenated benxoquinone that is an effective inhibitor of photosynthetic electron transport through the spinach photosystem II and the cytochrome b6/f-complex.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | DK6772500 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |






