A7694212
Tropaeolin O , Indicator , 547-57-9
Synonym(s):
4-([2,4-Dihydroxyphenyl]azo)benzenesulfonic acid sodium salt;Acid Orange 6;Chrysoin;Resorcinol yellow
CAS NO.:547-57-9
Empirical Formula: C12H11N2NaO5S
Molecular Weight: 318.28
MDL number: MFCD00007499
EINECS: 208-924-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB56.80 | In Stock |
|
| 5G | RMB114.40 | In Stock |
|
| 25G | RMB480.00 | In Stock |
|
| 100g | RMB1614.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Room Temperature |
| solubility | Solubility Soluble in water, ethanol |
| pka | 11.5, 11.9(at 25℃) |
| Colour Index | 14270 |
| form | Powder |
| color | Rust to dark brown |
| Odor | Odorless |
| PH | 11-13 |
| PH Range | Yellow (11.0) to red (12.7) |
| Water Solubility | Soluble in water and alcohol |
| λmax | 490nm |
| Merck | 14,9775 |
| BRN | 4173410 |
| Major Application | Photoresists, image forming materials, nonlinear optical (NLO) materials, etching, photography, inks, markers, lithium battery, leather dyes, polishing stainless steel, concrete, automobile radiators, textiles, cleaners, hair dyes, food storage, cosmetics, immunomodulating agents, disinfectant, antihistaminic agent, antimicrobial agent, nucleic acids |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChI | 1S/C12H10N2O5S.Na/c15-9-3-6-11(12(16)7-9)14-13-8-1-4-10(5-2-8)20(17,18)19;/h1-7,15-16H,(H,17,18,19);/q;+1/p-1/b14-13+; |
| InChIKey | COEZWFYORILMOM-IERUDJENSA-M |
| SMILES | [Na+].Oc1ccc(\N=N\c2ccc(cc2)S([O-])(=O)=O)c(O)c1 |
| LogP | 1.673 (est) |
| CAS DataBase Reference | 547-57-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, 4-[(2,4-dihydroxyphenyl)azo]-, monosodium salt (547-57-9) |
Description and Uses
Sodium (E)-4-(2, 4-Dihydroxyphenyl)diazenyl)benzenesulfonate is a food and an azo dye. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 1 |
| RTECS | DB5035000 |
| TSCA | TSCA listed |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |




