A7702312
Tetrabutylammonium borohydride , 95% , 33725-74-5
Synonym(s):
Tetra-n-butylammonium borohydride;Tetra-n-butylammonium-tetrahydridoborate
CAS NO.:33725-74-5
Empirical Formula: C16H40BN
Molecular Weight: 257.31
MDL number: MFCD00012035
EINECS: 251-658-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB204.00 | In Stock |
|
| 50g | RMB383.20 | In Stock |
|
| 100G | RMB715.20 | In Stock |
|
| 250g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-128 °C (lit.) |
| Flash point: | 140°(284°F) |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Sparingly), DMSO (Sparingly, Heated, Sonicated), Methanol (Slightly |
| form | Crystalline Powder and Chunks |
| color | White |
| Water Solubility | Soluble |
| Sensitive | Moisture Sensitive |
| BRN | 4212332 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C16H36N.BH4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H4/q+1;-1 |
| InChIKey | GMBOFJFPOCGSOI-UHFFFAOYSA-N |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[B+3]([H-])([H-])([H-])[H-] |
| CAS DataBase Reference | 33725-74-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, tetrahydroborate(1-) (33725-74-5) |
Description and Uses
Tetrabutylammonium Borohydride is a strong reducing agent used in the synthesis of hyperbranched polyglycerol grafting on the surface of silica-coated nanoparticles.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H261-H314 |
| Precautionary statements | P223-P231+P232-P260-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C,Xi |
| Risk Statements | 15-34-36/37/38 |
| Safety Statements | 26-36/37/39-43-7/8-37/39-25 |
| RIDADR | UN 3131 4.3/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Flammable/Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 4.3 |
| PackingGroup | I |
| HS Code | 29239000 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Skin Corr. 1B Water-react 2 |
| Limited Quantities | 0.5 Kg (1.1 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





