PRODUCT Properties
| Melting point: | 101-103 °C(lit.) |
| Boiling point: | 397.5±42.0 °C(Predicted) |
| Density | 1.114±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | Solid |
| color | White to light yellow |
| Water Solubility | Soluble in dichloromethane and methanol. Insoluble in water. |
| BRN | 644640 |
| InChI | InChI=1S/C16H14O2/c1-18-15-10-8-14(9-11-15)16(17)12-7-13-5-3-2-4-6-13/h2-12H,1H3 |
| InChIKey | KJHHAPASNNVTSN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C=C1)(=O)C=CC1=CC=CC=C1 |
| LogP | 4.180 (est) |
| CAS DataBase Reference | 959-23-9(CAS DataBase Reference) |
Description and Uses
4-Methoxychalcone is used as a precursor to prepare 3-(4-methoxy-phenyl)-3-morpholin-4-yl-1-phenyl-propan-1-one by reacting with morpholine in presence of heptanes as solvent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
