PRODUCT Properties
| Melting point: | 189-192℃ |
| Boiling point: | 646.1±55.0 °C(Predicted) |
| Density | 1.461±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol and methan |
| form | powder |
| pka | 6.36±0.20(Predicted) |
| color | White |
| InChI | InChI=1S/C18H16O8/c1-23-13-5-8(4-10(19)17(13)24-2)9-7-26-12-6-11(20)18(25-3)16(22)14(12)15(9)21/h4-7,19-20,22H,1-3H3 |
| InChIKey | TUGWPJJTQNLKCL-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1C1=CC(OC)=C(OC)C(O)=C1 |
Description and Uses
Irigenin is identified as an α-glucosidase inhibitors. Also, it is a lead compound to overcome Fibronectin EDA induced metastatic progression in lung carcinoma cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P330-P302+P352-P321-P304+P340-P305+P351+P338-P332+P313-P362+P364-P337+P313-P403+P233-P405-P501 |
