PRODUCT Properties
| Melting point: | 208℃ |
| Boiling point: | 833.5±65.0 °C(Predicted) |
| Density | 1.558±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| pka | 5.96±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | food and beverages |
| InChIKey | LNQCUTNLHUQZLR-OZJWLQQPSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)Oc2cc3[o]cc([c](c3c(c2OC)O)=O)c4cc(c(c(c4)O)OC)OC |
Description and Uses
Iridin is isolated from the iris species which exhibits antioxidant and antidiabetic activity and an α-amylase inhibitor. Lactate dehydrogenase inhibitor.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
