PRODUCT Properties
| Melting point: | 202~203℃ |
| Boiling point: | 908.6±65.0 °C(Predicted) |
| Density | 1.70 |
| storage temp. | -20°C |
| solubility | DMSO : 125 mg/mL (216.07 mM; Need ultrasonic) |
| form | powder |
| pka | 5.81±0.40(Predicted) |
| color | white to beige |
| biological source | (Cinnamomum sp.) |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | PUPKKEQDLNREIM-QNSQPKOQSA-N |
| SMILES | OC(C=C1)=CC=C1C2=C(O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)C(C4=C(O)C=C(O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)C=C4O2)=O |
Description and Uses
Kaempferitrin is a flavonoid glycoside that has been found in B. pinnatum and has diverse biological activities. It scavenges DPPH radicals (IC50 = 8.73 μg/ml) and is active against the bacteria S. aureus, P. aeruginosa, and S. typhi, as well as the fungi C. albicans, C. parapsilosis, and C. neoformans (MICs = 16-32 μg/ml). Kaempferitrin inhibits LPS-and IFN-γ-induced nitric oxide (NO) production in isolated mouse macrophages (IC50 = 40 μM). It decreases blood glucose levels in a rat model of alloxan-induced diabetes when administered at a dose of 100 mg/kg.
Kaempferitirin is a glycoside of Kaempferol (K100000), a plant flavonoid that exhibits antioxidant properties and is known to reduce risks of various types cancer and cardiovascular diseases. Kaempferitirin have been isolated as natural products from plants such as Hedyotis Verticilata.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H228 |
| Precautionary statements | P501-P261-P270-P240-P210-P241-P271-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |






