A7742412
Tetrahexylammonium bromide , 99% , 4328-13-6
Synonym(s):
THABr
CAS NO.:4328-13-6
Empirical Formula: C24H52BrN
Molecular Weight: 434.58
MDL number: MFCD00011858
EINECS: 224-363-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB175.20 | In Stock |
|
| 10g | RMB263.20 | In Stock |
|
| 25G | RMB535.20 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-100 °C (lit.) |
| Density | 1.0628 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | almost transparency[in Methanol] |
| solubility | almost transparency in Methanol |
| form | Powder or Flakes |
| color | White to light yellow |
| λmax | λ: 240 nm Amax: 0.06 λ: 250 nm Amax: 0.04 λ: 260 nm Amax: 0.03 λ: 500 nm Amax: 0.03 |
| Sensitive | Hygroscopic |
| BRN | 3637302 |
| InChI | 1S/C24H52N.BrH/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;/h5-24H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SYZCZDCAEVUSPM-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
| CAS DataBase Reference | 4328-13-6(CAS DataBase Reference) |
| EPA Substance Registry System | Tetrahexylammonium bromide (4328-13-6) |
Description and Uses
Tetrahexylammonium bromide can be used:
- As a hydrogen bond acceptor in the preparation of deep eutectic solvents which can be used for desulfurization and denitrogenation from n-heptane.
- To produce aqueous biphasic system for the heavy metal ions preconcentration.
- As a phase transfer salt to fabricate an optical chemical gas-sensor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |





