A7748858
LipoproteinLipaseActivator , 10mMinDMSO , 133208-93-2
Synonym(s):
Diethyl 4-[(4-bromo-2-cyanophenyl)carbamoyl]benzylphosphonate;Ibrolipim;OPF 009
CAS NO.：133208-93-2
Empirical Formula: C19H20BrN2O4P
Molecular Weight: 451.25
MDL number: MFCD00897807
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160.5-162.1 °C |
| Boiling point: | 512.5±50.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| pka | 11.51±0.70(Predicted) |
| color | off-white to pale yellow |
| InChI | 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
| InChIKey | KPRTURMJVWXURQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(cc1)C(=O)Nc2ccc(Br)cc2C#N)OCC |
Description and Uses
Lipoprotein Lipase Activator is an inducer of lipoprotein lipase mRNA.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
