A7755212
Tris(4-methoxyphenyl)phosphine , 95% , 855-38-9
CAS NO.:855-38-9
Empirical Formula: C21H21O3P
Molecular Weight: 352.36
MDL number: MFCD00014896
EINECS: 212-723-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB81.60 | In Stock |
|
| 25G | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-134 °C (lit.) |
| Boiling point: | 457.8±40.0 °C(Predicted) |
| Density | 1.1352 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to pale yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 2815911 |
| InChI | InChI=1S/C21H21O3P/c1-22-16-4-10-19(11-5-16)25(20-12-6-17(23-2)7-13-20)21-14-8-18(24-3)9-15-21/h4-15H,1-3H3 |
| InChIKey | UYUUAUOYLFIRJG-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1 |
| CAS DataBase Reference | 855-38-9(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphine, tris(4-methoxyphenyl)- (855-38-9) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![(S)-5,5'-Bis[di(3,5-di-tert-butyl-4-methoxyphenyl)phosphino]-4,4'-bi-1,3-benzodioxole](https://img.chemicalbook.com/CAS/GIF/210169-40-7.gif)
