A7756112
Tris(4-fluorophenyl)phosphine , 98% , 18437-78-0
Synonym(s):
Tri-(p-fluorophenyl)phosphine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-83 °C(lit.) |
| Boiling point: | 160°C/0.1mmHg(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to very slightly yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 919838 |
| InChI | InChI=1S/C18H12F3P/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H |
| InChIKey | GEPJPYNDFSOARB-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(F)C=C1)(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1 |
| CAS DataBase Reference | 18437-78-0(CAS DataBase Reference) |
Description and Uses
Ligand for rhodium-catalyzed oxygenative addition to terminal alkynes for a greener synthesis esters, amides, and carboxylic acids.
Rhodium-Catalyzed Oxygenative Addition to Terminal Alkynes for the Synthesis of Esters, Amides, and Carboxylic Acids
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
