BD0649245
Tris(3-fluorophenyl)phosphine , 97% , 23039-94-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB148.00 | In Stock |
|
| 25g | RMB582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62 °C |
| Boiling point: | 371.1±37.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| color | Off-white |
| Sensitive | Air Sensitive |
| BRN | 2946854 |
| InChI | InChI=1S/C18H12F3P/c19-13-4-1-7-16(10-13)22(17-8-2-5-14(20)11-17)18-9-3-6-15(21)12-18/h1-12H |
| InChIKey | CUTRINLXFPIWQB-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CC(F)=C1)(C1=CC=CC(F)=C1)C1=CC=CC(F)=C1 |
| CAS DataBase Reference | 23039-94-3(CAS DataBase Reference) |
Description and Uses
Tri(3-fluorophenyl)phosphine is an organophosphorus ligand commonly used in organometallic chemistry and catalysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| Hazard Note | Irritant |
| HS Code | 2931599090 |
